C12H15ClN2O6S — CID 54587968
2-amino-5-(3-chloro-4-methyl-5-sulfoanilino)-5-oxopentanoic acid (PubChem CID 54587968) has the molecular formula C12H15ClN2O6S and a molecular weight of 350.78 g/mol. Its IUPAC name is 2-amino-5-(3-chloro-4-methyl-5-sulfoanilino)-5-oxopentanoic acid.
| Compound Name | 2-amino-5-(3-chloro-4-methyl-5-sulfoanilino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54587968 |
| Molecular Formula | C12H15ClN2O6S |
| Molecular Weight | 350.78 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-amino-5-(3-chloro-4-methyl-5-sulfoanilino)-5-oxopentanoic acid |
| SMILES | Cc1c(Cl)cc(NC(=O)CCC(N)C(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C12H15ClN2O6S/c1-6-8(13)4-7(5-10(6)22(19,20)21)15-11(16)3-2-9(14)12(17)18/h4-5,9H,2-3,14H2,1H3,(H,15,16)(H,17,18)(H,19,20,21) |
| InChIKey | GWNUGDBDJPTJHP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.78 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|