C11H13ClN2O7S — CID 54587970
2-amino-3-[(3-chloro-4-methyl-5-sulfophenyl)carbamoyloxy]propanoic acid (PubChem CID 54587970) has the molecular formula C11H13ClN2O7S and a molecular weight of 352.75 g/mol. Its IUPAC name is 2-amino-3-[(3-chloro-4-methyl-5-sulfophenyl)carbamoyloxy]propanoic acid.
| Compound Name | 2-amino-3-[(3-chloro-4-methyl-5-sulfophenyl)carbamoyloxy]propanoic acid |
|---|---|
| PubChem CID | 54587970 |
| Molecular Formula | C11H13ClN2O7S |
| Molecular Weight | 352.75 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-amino-3-[(3-chloro-4-methyl-5-sulfophenyl)carbamoyloxy]propanoic acid |
| SMILES | Cc1c(Cl)cc(NC(=O)OCC(N)C(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C11H13ClN2O7S/c1-5-7(12)2-6(3-9(5)22(18,19)20)14-11(17)21-4-8(13)10(15)16/h2-3,8H,4,13H2,1H3,(H,14,17)(H,15,16)(H,18,19,20) |
| InChIKey | XKJATIHCDBKYQG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.75 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|