C11H14ClNO3 — CID 64786534
2-methylpropyl N-(4-chloro-3-hydroxyphenyl)carbamate (PubChem CID 64786534) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-methylpropyl N-(4-chloro-3-hydroxyphenyl)carbamate.
| Compound Name | 2-methylpropyl N-(4-chloro-3-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 64786534 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-methylpropyl N-(4-chloro-3-hydroxyphenyl)carbamate |
| SMILES | CC(C)COC(=O)Nc1ccc(Cl)c(O)c1 |
| InChI | InChI=1S/C11H14ClNO3/c1-7(2)6-16-11(15)13-8-3-4-9(12)10(14)5-8/h3-5,7,14H,6H2,1-2H3,(H,13,15) |
| InChIKey | CGSVSTNKKAYNGW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |