C14H17Cl2NO4 — CID 159240660
2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl 3-methylbutanoate (PubChem CID 159240660) has the molecular formula C14H17Cl2NO4 and a molecular weight of 334.20 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl 3-methylbutanoate.
| Compound Name | 2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl 3-methylbutanoate |
|---|---|
| PubChem CID | 159240660 |
| Molecular Formula | C14H17Cl2NO4 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCCOC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO4/c1-9(2)7-13(18)20-5-6-21-14(19)17-10-3-4-11(15)12(16)8-10/h3-4,8-9H,5-7H2,1-2H3,(H,17,19) |
| InChIKey | ZCEPUQDXOSDVDC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|