C15H11Br2Cl2NO3 — CID 2244801
2-(2,4-dibromophenoxy)ethyl N-(3,4-dichlorophenyl)carbamate (PubChem CID 2244801) has the molecular formula C15H11Br2Cl2NO3 and a molecular weight of 483.97 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)ethyl N-(3,4-dichlorophenyl)carbamate.
| Compound Name | 2-(2,4-dibromophenoxy)ethyl N-(3,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 2244801 |
| Molecular Formula | C15H11Br2Cl2NO3 |
| Molecular Weight | 483.97 g/mol |
| Exact Mass | 480.85 |
| IUPAC Name | 2-(2,4-dibromophenoxy)ethyl N-(3,4-dichlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)OCCOc1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H11Br2Cl2NO3/c16-9-1-4-14(11(17)7-9)22-5-6-23-15(21)20-10-2-3-12(18)13(19)8-10/h1-4,7-8H,5-6H2,(H,20,21) |
| InChIKey | MGLUHXPSDFAIBH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.97 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|