C24H24Cl5N3O16S3 — CID 159177232
2-[2-[(3,4-dichlorophenyl)carbamoyloxy]ethoxy]-2-oxoethanesulfonic acid;2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl 2-methylsulfonylacetate;N-(oxomethylidene)sulfamoyl chloride (PubChem CID 159177232) has the molecular formula C24H24Cl5N3O16S3 and a molecular weight of 883.93 g/mol. Its IUPAC name is 2-[2-[(3,4-dichlorophenyl)carbamoyloxy]ethoxy]-2-oxoethanesulfonic acid;2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl 2-methylsulfonylacetate;N-(oxomethylidene)sulfamoyl chloride.
| Compound Name | 2-[2-[(3,4-dichlorophenyl)carbamoyloxy]ethoxy]-2-oxoethanesulfonic acid;2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl 2-methylsulfonylacetate;N-(oxomethylidene)sulfamoyl chloride |
|---|---|
| PubChem CID | 159177232 |
| Molecular Formula | C24H24Cl5N3O16S3 |
| Molecular Weight | 883.93 g/mol |
| Exact Mass | 880.88 |
| IUPAC Name | 2-[2-[(3,4-dichlorophenyl)carbamoyloxy]ethoxy]-2-oxoethanesulfonic acid;2-[(3,4-dichlorophenyl)carbamoyloxy]ethyl 2-methylsulfonylacetate;N-(oxomethylidene)sulfamoyl chloride |
| SMILES | CS(=O)(=O)CC(=O)OCCOC(=O)Nc1ccc(Cl)c(Cl)c1.O=C(CS(=O)(=O)O)OCCOC(=O)Nc1ccc(Cl)c(Cl)c1.O=C=NS(=O)(=O)Cl |
| InChI | InChI=1S/C12H13Cl2NO6S.C11H11Cl2NO7S.CClNO3S/c1-22(18,19)7-11(16)20-4-5-21-12(17)15-8-2-3-9(13)10(14)6-8;12-8-2-1-7(5-9(8)13)14-11(16)21-4-3-20-10(15)6-22(17,18)19;2-7(5,6)3-1-4/h2-3,6H,4-5,7H2,1H3,(H,15,17);1-2,5H,3-4,6H2,(H,14,16)(H,17,18,19); |
| InChIKey | KMKWQGMYMMLLMM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 281.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.93 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|