C13H18ClNO4 — CID 13303966
ethyl N-(3-chloro-4,5-diethoxyphenyl)carbamate (PubChem CID 13303966) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is ethyl N-(3-chloro-4,5-diethoxyphenyl)carbamate.
| Compound Name | ethyl N-(3-chloro-4,5-diethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 13303966 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | ethyl N-(3-chloro-4,5-diethoxyphenyl)carbamate |
| SMILES | CCOC(=O)Nc1cc(Cl)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C13H18ClNO4/c1-4-17-11-8-9(15-13(16)19-6-3)7-10(14)12(11)18-5-2/h7-8H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | KMFXTLYHFDJATC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |