C15H17Cl2NO4 — CID 13303978
4-chlorobut-2-ynyl N-(3-chloro-4,5-diethoxyphenyl)carbamate (PubChem CID 13303978) has the molecular formula C15H17Cl2NO4 and a molecular weight of 346.21 g/mol. Its IUPAC name is 4-chlorobut-2-ynyl N-(3-chloro-4,5-diethoxyphenyl)carbamate.
| Compound Name | 4-chlorobut-2-ynyl N-(3-chloro-4,5-diethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 13303978 |
| Molecular Formula | C15H17Cl2NO4 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-chlorobut-2-ynyl N-(3-chloro-4,5-diethoxyphenyl)carbamate |
| SMILES | CCOc1cc(NC(=O)OCC#CCCl)cc(Cl)c1OCC |
| InChI | InChI=1S/C15H17Cl2NO4/c1-3-20-13-10-11(9-12(17)14(13)21-4-2)18-15(19)22-8-6-5-7-16/h9-10H,3-4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | JFBOLIKWMLFRCE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|