C10H14ClNO2 — CID 13335752
3-chloro-4,5-diethoxyaniline (PubChem CID 13335752) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is 3-chloro-4,5-diethoxyaniline.
| Compound Name | 3-chloro-4,5-diethoxyaniline |
|---|---|
| PubChem CID | 13335752 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 3-chloro-4,5-diethoxyaniline |
| SMILES | CCOc1cc(N)cc(Cl)c1OCC |
| InChI | InChI=1S/C10H14ClNO2/c1-3-13-9-6-7(12)5-8(11)10(9)14-4-2/h5-6H,3-4,12H2,1-2H3 |
| InChIKey | RNCOILIUSIYDCB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|