C17H21ClN4O8S3 — CID 160942293
3-aminobenzenesulfonic acid;(2S)-2-amino-3-[(3-chloro-4-methyl-5-sulfophenyl)carbamothioylamino]propanoic acid (PubChem CID 160942293) has the molecular formula C17H21ClN4O8S3 and a molecular weight of 541.03 g/mol. Its IUPAC name is 3-aminobenzenesulfonic acid;(2S)-2-amino-3-[(3-chloro-4-methyl-5-sulfophenyl)carbamothioylamino]propanoic acid.
| Compound Name | 3-aminobenzenesulfonic acid;(2S)-2-amino-3-[(3-chloro-4-methyl-5-sulfophenyl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 160942293 |
| Molecular Formula | C17H21ClN4O8S3 |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | 3-aminobenzenesulfonic acid;(2S)-2-amino-3-[(3-chloro-4-methyl-5-sulfophenyl)carbamothioylamino]propanoic acid |
| SMILES | Cc1c(Cl)cc(NC(=S)NC[C@H](N)C(=O)O)cc1S(=O)(=O)O.Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H14ClN3O5S2.C6H7NO3S/c1-5-7(12)2-6(3-9(5)22(18,19)20)15-11(21)14-4-8(13)10(16)17;7-5-2-1-3-6(4-5)11(8,9)10/h2-3,8H,4,13H2,1H3,(H,16,17)(H2,14,15,21)(H,18,19,20);1-4H,7H2,(H,8,9,10)/t8-;/m0./s1 |
| InChIKey | SUQUXUCRHZNEQZ-QRPNPIFTSA-N |
| XLogP | 1.11 |
| TPSA | 222.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|