C12H13Cl3N2O4 — CID 118659098
[3-chloro-5-(2-chloroethoxycarbonylamino)-2-(1-chloroethyl)phenyl]carbamic acid (PubChem CID 118659098) has the molecular formula C12H13Cl3N2O4 and a molecular weight of 355.61 g/mol. Its IUPAC name is [3-chloro-5-(2-chloroethoxycarbonylamino)-2-(1-chloroethyl)phenyl]carbamic acid.
| Compound Name | [3-chloro-5-(2-chloroethoxycarbonylamino)-2-(1-chloroethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 118659098 |
| Molecular Formula | C12H13Cl3N2O4 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | [3-chloro-5-(2-chloroethoxycarbonylamino)-2-(1-chloroethyl)phenyl]carbamic acid |
| SMILES | CC(Cl)c1c(Cl)cc(NC(=O)OCCCl)cc1NC(=O)O |
| InChI | InChI=1S/C12H13Cl3N2O4/c1-6(14)10-8(15)4-7(5-9(10)17-11(18)19)16-12(20)21-3-2-13/h4-6,17H,2-3H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | ZDOOWIHETJOKKX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|