About 2-chloroethyl N-(4-methoxyphenyl)carbamate
2-chloroethyl N-(4-methoxyphenyl)carbamate (PubChem CID 4190237) has the molecular formula C10H12ClNO3
and a molecular weight of 229.66 g/mol. Its IUPAC name is 2-chloroethyl N-(4-methoxyphenyl)carbamate.
Molecular Properties
| Compound Name | 2-chloroethyl N-(4-methoxyphenyl)carbamate |
| PubChem CID | 4190237 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-chloroethyl N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OCCCl)cc1 |
| InChI | InChI=1S/C10H12ClNO3/c1-14-9-4-2-8(3-5-9)12-10(13)15-7-6-11/h2-5H,6-7H2,1H3,(H,12,13) |
| InChIKey | MIXXDQCIWOLJSB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl N-(4-methoxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl N-(4-methoxyphenyl)carbamate?
The IUPAC name of 2-chloroethyl N-(4-methoxyphenyl)carbamate (CID 4190237) is 2-chloroethyl N-(4-methoxyphenyl)carbamate.
What is the SMILES notation for 2-chloroethyl N-(4-methoxyphenyl)carbamate?
The canonical SMILES for 2-chloroethyl N-(4-methoxyphenyl)carbamate is COc1ccc(NC(=O)OCCCl)cc1.
What is the InChIKey of 2-chloroethyl N-(4-methoxyphenyl)carbamate?
The InChIKey is MIXXDQCIWOLJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO3/c1-14-9-4-2-8(3-5-9)12-10(13)15-7-6-11/h2-5H,6-7H2,1H3,(H,12,13).
What are the key properties of 2-chloroethyl N-(4-methoxyphenyl)carbamate?
2-chloroethyl N-(4-methoxyphenyl)carbamate has a molecular weight of 229.66 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl N-(4-methoxyphenyl)carbamate is sourced from PubChem (CID 4190237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).