C15H23NO3 — CID 59019482
2,2,3-trimethylbutyl N-(4-methoxyphenyl)carbamate (PubChem CID 59019482) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2,2,3-trimethylbutyl N-(4-methoxyphenyl)carbamate.
| Compound Name | 2,2,3-trimethylbutyl N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 59019482 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2,2,3-trimethylbutyl N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OCC(C)(C)C(C)C)cc1 |
| InChI | InChI=1S/C15H23NO3/c1-11(2)15(3,4)10-19-14(17)16-12-6-8-13(18-5)9-7-12/h6-9,11H,10H2,1-5H3,(H,16,17) |
| InChIKey | WVMJUVIAITUHFN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |