C12H16N2O5 — CID 121008998
(2S)-2-amino-3-[(4-ethoxyphenyl)carbamoyloxy]propanoic acid (PubChem CID 121008998) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is (2S)-2-amino-3-[(4-ethoxyphenyl)carbamoyloxy]propanoic acid.
| Compound Name | (2S)-2-amino-3-[(4-ethoxyphenyl)carbamoyloxy]propanoic acid |
|---|---|
| PubChem CID | 121008998 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2S)-2-amino-3-[(4-ethoxyphenyl)carbamoyloxy]propanoic acid |
| SMILES | CCOc1ccc(NC(=O)OC[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C12H16N2O5/c1-2-18-9-5-3-8(4-6-9)14-12(17)19-7-10(13)11(15)16/h3-6,10H,2,7,13H2,1H3,(H,14,17)(H,15,16)/t10-/m0/s1 |
| InChIKey | YKXKKDYJIOFJCB-JTQLQIEISA-N |
| XLogP | 1.05 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |