C30H40N2O8 — CID 160807108
bis(ethyl N-(4-ethoxyphenyl)carbamate);octa-3,5-diyne-1,8-diol (PubChem CID 160807108) has the molecular formula C30H40N2O8 and a molecular weight of 556.66 g/mol. Its IUPAC name is bis(ethyl N-(4-ethoxyphenyl)carbamate);octa-3,5-diyne-1,8-diol.
| Compound Name | bis(ethyl N-(4-ethoxyphenyl)carbamate);octa-3,5-diyne-1,8-diol |
|---|---|
| PubChem CID | 160807108 |
| Molecular Formula | C30H40N2O8 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | bis(ethyl N-(4-ethoxyphenyl)carbamate);octa-3,5-diyne-1,8-diol |
| SMILES | CCOC(=O)Nc1ccc(OCC)cc1.CCOC(=O)Nc1ccc(OCC)cc1.OCCC#CC#CCCO |
| InChI | InChI=1S/2C11H15NO3.C8H10O2/c2*1-3-14-10-7-5-9(6-8-10)12-11(13)15-4-2;9-7-5-3-1-2-4-6-8-10/h2*5-8H,3-4H2,1-2H3,(H,12,13);9-10H,5-8H2 |
| InChIKey | SDVJDVMFADKVIQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|