C11H13IN2O4 — CID 131873945
(2S)-2-amino-5-(4-hydroxy-3-iodoanilino)-5-oxopentanoic acid (PubChem CID 131873945) has the molecular formula C11H13IN2O4 and a molecular weight of 364.14 g/mol. Its IUPAC name is (2S)-2-amino-5-(4-hydroxy-3-iodoanilino)-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-(4-hydroxy-3-iodoanilino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 131873945 |
| Molecular Formula | C11H13IN2O4 |
| Molecular Weight | 364.14 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | (2S)-2-amino-5-(4-hydroxy-3-iodoanilino)-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)Nc1ccc(O)c(I)c1)C(=O)O |
| InChI | InChI=1S/C11H13IN2O4/c12-7-5-6(1-3-9(7)15)14-10(16)4-2-8(13)11(17)18/h1,3,5,8,15H,2,4,13H2,(H,14,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | JTQRLAKDOHQPAK-QMMMGPOBSA-N |
| XLogP | 1.13 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|