C15H23N3O5 — CID 14457220
(2S)-2-amino-5-[4-[bis(2-hydroxyethyl)amino]anilino]-5-oxopentanoic acid (PubChem CID 14457220) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is (2S)-2-amino-5-[4-[bis(2-hydroxyethyl)amino]anilino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[4-[bis(2-hydroxyethyl)amino]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 14457220 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (2S)-2-amino-5-[4-[bis(2-hydroxyethyl)amino]anilino]-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)Nc1ccc(N(CCO)CCO)cc1)C(=O)O |
| InChI | InChI=1S/C15H23N3O5/c16-13(15(22)23)5-6-14(21)17-11-1-3-12(4-2-11)18(7-9-19)8-10-20/h1-4,13,19-20H,5-10,16H2,(H,17,21)(H,22,23)/t13-/m0/s1 |
| InChIKey | YFZLMRCPRXFOME-ZDUSSCGKSA-N |
| XLogP | -0.39 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|