C12H14N2O6 — CID 12873554
5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 12873554) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is 5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 12873554 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | N[C@@H](CCC(=O)Nc1ccc(O)c(C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C12H14N2O6/c13-8(12(19)20)2-4-10(16)14-6-1-3-9(15)7(5-6)11(17)18/h1,3,5,8,15H,2,4,13H2,(H,14,16)(H,17,18)(H,19,20)/t8-/m0/s1 |
| InChIKey | SXXQCQDCWZFRGY-QMMMGPOBSA-N |
| XLogP | 0.22 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|