C16H10NaO10S3 — CID 87275188
CID 87275188 (PubChem CID 87275188) has the molecular formula C16H10NaO10S3 and a molecular weight of 481.44 g/mol.
| Compound Name | CID 87275188 |
|---|---|
| PubChem CID | 87275188 |
| Molecular Formula | C16H10NaO10S3 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 480.93 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(O)c2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)c4ccc1c2c34.[Na] |
| InChI | InChI=1S/C16H10O10S3.Na/c17-11-5-12(27(18,19)20)8-3-4-10-14(29(24,25)26)6-13(28(21,22)23)9-2-1-7(11)15(8)16(9)10;/h1-6,17H,(H,18,19,20)(H,21,22,23)(H,24,25,26); |
| InChIKey | HFFQFXKVTMRKGH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|