C17H11O8S3- — CID 170246456
3-hydroxy-6-methylsulfonyl-8-sulfopyrene-1-sulfinate (PubChem CID 170246456) has the molecular formula C17H11O8S3- and a molecular weight of 439.47 g/mol. Its IUPAC name is 3-hydroxy-6-methylsulfonyl-8-sulfopyrene-1-sulfinate.
| Compound Name | 3-hydroxy-6-methylsulfonyl-8-sulfopyrene-1-sulfinate |
|---|---|
| PubChem CID | 170246456 |
| Molecular Formula | C17H11O8S3- |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 438.96 |
| IUPAC Name | 3-hydroxy-6-methylsulfonyl-8-sulfopyrene-1-sulfinate |
| SMILES | CS(=O)(=O)c1cc(S(=O)(=O)O)c2ccc3c(S(=O)[O-])cc(O)c4ccc1c2c43 |
| InChI | InChI=1S/C17H12O8S3/c1-27(21,22)14-7-15(28(23,24)25)11-5-3-9-13(26(19)20)6-12(18)8-2-4-10(14)17(11)16(8)9/h2-7,18H,1H3,(H,19,20)(H,23,24,25)/p-1 |
| InChIKey | ORFTWNDMCPUVEI-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 148.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|