C32H30N3O9S3- — CID 173380324
8-hydroxy-6-[methyl-[4-[3-(2-methylprop-2-enoylamino)propylcarbamoyl]phenyl]sulfamoyl]-3-methylsulfonylpyrene-1-sulfinate (PubChem CID 173380324) has the molecular formula C32H30N3O9S3- and a molecular weight of 696.80 g/mol. Its IUPAC name is 8-hydroxy-6-[methyl-[4-[3-(2-methylprop-2-enoylamino)propylcarbamoyl]phenyl]sulfamoyl]-3-methylsulfonylpyrene-1-sulfinate.
| Compound Name | 8-hydroxy-6-[methyl-[4-[3-(2-methylprop-2-enoylamino)propylcarbamoyl]phenyl]sulfamoyl]-3-methylsulfonylpyrene-1-sulfinate |
|---|---|
| PubChem CID | 173380324 |
| Molecular Formula | C32H30N3O9S3- |
| Molecular Weight | 696.80 g/mol |
| Exact Mass | 696.11 |
| IUPAC Name | 8-hydroxy-6-[methyl-[4-[3-(2-methylprop-2-enoylamino)propylcarbamoyl]phenyl]sulfamoyl]-3-methylsulfonylpyrene-1-sulfinate |
| SMILES | C=C(C)C(=O)NCCCNC(=O)c1ccc(N(C)S(=O)(=O)c2cc(O)c3ccc4c(S(=O)[O-])cc(S(C)(=O)=O)c5ccc2c3c45)cc1 |
| InChI | InChI=1S/C32H31N3O9S3/c1-18(2)31(37)33-14-5-15-34-32(38)19-6-8-20(9-7-19)35(3)47(43,44)28-16-25(36)21-10-11-22-26(45(39)40)17-27(46(4,41)42)23-12-13-24(28)29(21)30(22)23/h6-13,16-17,36H,1,5,14-15H2,2-4H3,(H,33,37)(H,34,38)(H,39,40)/p-1 |
| InChIKey | ILOBNHNBYKIWMV-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 190.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|