C15H19N5O2 — CID 102482741
4-(azidomethyl)-N-[3-(2-methylprop-2-enoylamino)propyl]benzamide (PubChem CID 102482741) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-(azidomethyl)-N-[3-(2-methylprop-2-enoylamino)propyl]benzamide.
| Compound Name | 4-(azidomethyl)-N-[3-(2-methylprop-2-enoylamino)propyl]benzamide |
|---|---|
| PubChem CID | 102482741 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-(azidomethyl)-N-[3-(2-methylprop-2-enoylamino)propyl]benzamide |
| SMILES | C=C(C)C(=O)NCCCNC(=O)c1ccc(CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C15H19N5O2/c1-11(2)14(21)17-8-3-9-18-15(22)13-6-4-12(5-7-13)10-19-20-16/h4-7H,1,3,8-10H2,2H3,(H,17,21)(H,18,22) |
| InChIKey | HLDQFWFWIUFWQN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|