C18H20N6O4 — CID 122579596
4-(azidomethyl)-N-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propyl]benzamide (PubChem CID 122579596) has the molecular formula C18H20N6O4 and a molecular weight of 384.40 g/mol. Its IUPAC name is 4-(azidomethyl)-N-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propyl]benzamide.
| Compound Name | 4-(azidomethyl)-N-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propyl]benzamide |
|---|---|
| PubChem CID | 122579596 |
| Molecular Formula | C18H20N6O4 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-(azidomethyl)-N-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propyl]benzamide |
| SMILES | [N-]=[N+]=NCc1ccc(C(=O)NCCCNC(=O)CCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C18H20N6O4/c19-23-22-12-13-2-4-14(5-3-13)18(28)21-10-1-9-20-15(25)8-11-24-16(26)6-7-17(24)27/h2-7H,1,8-12H2,(H,20,25)(H,21,28) |
| InChIKey | ZYJOZVZZUBYMFT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 144.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|