C13H19N5O — CID 174020315
4-(azidomethyl)-N-[(3S)-3-(methylamino)butyl]benzamide (PubChem CID 174020315) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 4-(azidomethyl)-N-[(3S)-3-(methylamino)butyl]benzamide.
| Compound Name | 4-(azidomethyl)-N-[(3S)-3-(methylamino)butyl]benzamide |
|---|---|
| PubChem CID | 174020315 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 4-(azidomethyl)-N-[(3S)-3-(methylamino)butyl]benzamide |
| SMILES | CN[C@@H](C)CCNC(=O)c1ccc(CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C13H19N5O/c1-10(15-2)7-8-16-13(19)12-5-3-11(4-6-12)9-17-18-14/h3-6,10,15H,7-9H2,1-2H3,(H,16,19)/t10-/m0/s1 |
| InChIKey | MGCOZPLVSZQSSQ-JTQLQIEISA-N |
| XLogP | 2.22 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|