C20H20N6O2 — CID 118722549
4-(azidomethyl)-N-[(2S)-1-(cyanomethylamino)-1-oxo-4-phenylbutan-2-yl]benzamide (PubChem CID 118722549) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-(azidomethyl)-N-[(2S)-1-(cyanomethylamino)-1-oxo-4-phenylbutan-2-yl]benzamide.
| Compound Name | 4-(azidomethyl)-N-[(2S)-1-(cyanomethylamino)-1-oxo-4-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 118722549 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-(azidomethyl)-N-[(2S)-1-(cyanomethylamino)-1-oxo-4-phenylbutan-2-yl]benzamide |
| SMILES | N#CCNC(=O)[C@H](CCc1ccccc1)NC(=O)c1ccc(CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C20H20N6O2/c21-12-13-23-20(28)18(11-8-15-4-2-1-3-5-15)25-19(27)17-9-6-16(7-10-17)14-24-26-22/h1-7,9-10,18H,8,11,13-14H2,(H,23,28)(H,25,27)/t18-/m0/s1 |
| InChIKey | VKKTVTPKHMZGJQ-SFHVURJKSA-N |
| XLogP | 2.87 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|