C19H18BrN3O4S — CID 18381837
N-[3-[(4-bromophenyl)methylsulfonyl]-1-(cyanomethylamino)-1-oxopropan-2-yl]benzamide (PubChem CID 18381837) has the molecular formula C19H18BrN3O4S and a molecular weight of 464.34 g/mol. Its IUPAC name is N-[3-[(4-bromophenyl)methylsulfonyl]-1-(cyanomethylamino)-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[3-[(4-bromophenyl)methylsulfonyl]-1-(cyanomethylamino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 18381837 |
| Molecular Formula | C19H18BrN3O4S |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | N-[3-[(4-bromophenyl)methylsulfonyl]-1-(cyanomethylamino)-1-oxopropan-2-yl]benzamide |
| SMILES | N#CCNC(=O)C(CS(=O)(=O)Cc1ccc(Br)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18BrN3O4S/c20-16-8-6-14(7-9-16)12-28(26,27)13-17(19(25)22-11-10-21)23-18(24)15-4-2-1-3-5-15/h1-9,17H,11-13H2,(H,22,25)(H,23,24) |
| InChIKey | NBBMPTSSPQFBQF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|