C19H18FN3O4S — CID 10294577
N-[1-(cyanomethylamino)-3-(2-fluoro-3-methylphenyl)sulfonyl-1-oxopropan-2-yl]benzamide (PubChem CID 10294577) has the molecular formula C19H18FN3O4S and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-3-(2-fluoro-3-methylphenyl)sulfonyl-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[1-(cyanomethylamino)-3-(2-fluoro-3-methylphenyl)sulfonyl-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 10294577 |
| Molecular Formula | C19H18FN3O4S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[1-(cyanomethylamino)-3-(2-fluoro-3-methylphenyl)sulfonyl-1-oxopropan-2-yl]benzamide |
| SMILES | Cc1cccc(S(=O)(=O)CC(NC(=O)c2ccccc2)C(=O)NCC#N)c1F |
| InChI | InChI=1S/C19H18FN3O4S/c1-13-6-5-9-16(17(13)20)28(26,27)12-15(19(25)22-11-10-21)23-18(24)14-7-3-2-4-8-14/h2-9,15H,11-12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | ICNFAQFJJOWUBN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|