C14H14F3N3O4S — CID 23018532
N-[1-(cyanomethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]-3-(trifluoromethyl)benzamide (PubChem CID 23018532) has the molecular formula C14H14F3N3O4S and a molecular weight of 377.34 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(cyanomethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 23018532 |
| Molecular Formula | C14H14F3N3O4S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-[1-(cyanomethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CS(=O)(=O)CC(NC(=O)c1cccc(C(F)(F)F)c1)C(=O)NCC#N |
| InChI | InChI=1S/C14H14F3N3O4S/c1-25(23,24)8-11(13(22)19-6-5-18)20-12(21)9-3-2-4-10(7-9)14(15,16)17/h2-4,7,11H,6,8H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | UVOAGLYKWIKWEN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|