C20H18F3N3O4S2 — CID 18381857
N-[1-(cyanomethylamino)-1-oxo-3-[[4-(trifluoromethylsulfanyl)phenyl]methylsulfonyl]propan-2-yl]benzamide (PubChem CID 18381857) has the molecular formula C20H18F3N3O4S2 and a molecular weight of 485.51 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-1-oxo-3-[[4-(trifluoromethylsulfanyl)phenyl]methylsulfonyl]propan-2-yl]benzamide.
| Compound Name | N-[1-(cyanomethylamino)-1-oxo-3-[[4-(trifluoromethylsulfanyl)phenyl]methylsulfonyl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 18381857 |
| Molecular Formula | C20H18F3N3O4S2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | N-[1-(cyanomethylamino)-1-oxo-3-[[4-(trifluoromethylsulfanyl)phenyl]methylsulfonyl]propan-2-yl]benzamide |
| SMILES | N#CCNC(=O)C(CS(=O)(=O)Cc1ccc(SC(F)(F)F)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18F3N3O4S2/c21-20(22,23)31-16-8-6-14(7-9-16)12-32(29,30)13-17(19(28)25-11-10-24)26-18(27)15-4-2-1-3-5-15/h1-9,17H,11-13H2,(H,25,28)(H,26,27) |
| InChIKey | QQUFBEWMRSJZFG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|