C15H18F3NO3S — CID 71994715
N-(1-methylsulfonylpropan-2-yl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide (PubChem CID 71994715) has the molecular formula C15H18F3NO3S and a molecular weight of 349.37 g/mol. Its IUPAC name is N-(1-methylsulfonylpropan-2-yl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide.
| Compound Name | N-(1-methylsulfonylpropan-2-yl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 71994715 |
| Molecular Formula | C15H18F3NO3S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(1-methylsulfonylpropan-2-yl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide |
| SMILES | CC(=CC(=O)NC(C)CS(C)(=O)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F3NO3S/c1-10(7-14(20)19-11(2)9-23(3,21)22)12-5-4-6-13(8-12)15(16,17)18/h4-8,11H,9H2,1-3H3,(H,19,20) |
| InChIKey | WIXKUHFKGFKKTL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|