C12H10F3N5O — CID 75533888
(Z)-N-(2H-tetrazol-5-yl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide (PubChem CID 75533888) has the molecular formula C12H10F3N5O and a molecular weight of 297.24 g/mol. Its IUPAC name is (Z)-N-(2H-tetrazol-5-yl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide.
| Compound Name | (Z)-N-(2H-tetrazol-5-yl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 75533888 |
| Molecular Formula | C12H10F3N5O |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (Z)-N-(2H-tetrazol-5-yl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide |
| SMILES | C/C(=C/C(=O)Nc1nn[nH]n1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F3N5O/c1-7(5-10(21)16-11-17-19-20-18-11)8-3-2-4-9(6-8)12(13,14)15/h2-6H,1H3,(H2,16,17,18,19,20,21)/b7-5- |
| InChIKey | OXOZNLSIIYJRLE-ALCCZGGFSA-N |
| XLogP | 2.26 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|