C17H11F6NO — CID 177472811
(Z)-3-amino-1,3-bis[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 177472811) has the molecular formula C17H11F6NO and a molecular weight of 359.27 g/mol. Its IUPAC name is (Z)-3-amino-1,3-bis[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (Z)-3-amino-1,3-bis[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 177472811 |
| Molecular Formula | C17H11F6NO |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (Z)-3-amino-1,3-bis[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | N/C(=C\C(=O)c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11F6NO/c18-16(19,20)12-5-1-3-10(7-12)14(24)9-15(25)11-4-2-6-13(8-11)17(21,22)23/h1-9H,24H2/b14-9- |
| InChIKey | HQESENSYIZMVDC-ZROIWOOFSA-N |
| XLogP | 4.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|