About 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride
3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride (PubChem CID 157401586) has the molecular formula C16H11ClF6NO2-
and a molecular weight of 398.71 g/mol. Its IUPAC name is 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride |
| PubChem CID | 157401586 |
| Molecular Formula | C16H11ClF6NO2- |
| Molecular Weight | 398.71 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride |
| SMILES | NC(=O)c1cccc(C(F)(F)F)c1.O=Cc1cccc(C(F)(F)F)c1.[Cl-] |
| InChI | InChI=1S/C8H6F3NO.C8H5F3O.ClH/c9-8(10,11)6-3-1-2-5(4-6)7(12)13;9-8(10,11)7-3-1-2-6(4-7)5-12;/h1-4H,(H2,12,13);1-5H;1H/p-1 |
| InChIKey | RLMSIWWWGKANCQ-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.71 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride?
The IUPAC name of 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride (CID 157401586) is 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride.
What is the SMILES notation for 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride?
The canonical SMILES for 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride is NC(=O)c1cccc(C(F)(F)F)c1.O=Cc1cccc(C(F)(F)F)c1.[Cl-].
What is the InChIKey of 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride?
The InChIKey is RLMSIWWWGKANCQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6F3NO.C8H5F3O.ClH/c9-8(10,11)6-3-1-2-5(4-6)7(12)13;9-8(10,11)7-3-1-2-6(4-7)5-12;/h1-4H,(H2,12,13);1-5H;1H/p-1.
What are the key properties of 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride?
3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride has a molecular weight of 398.71 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)benzaldehyde;3-(trifluoromethyl)benzamide;chloride is sourced from PubChem (CID 157401586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).