C9H6F4O — CID 84722173
3-(1,1,2,2-tetrafluoroethyl)benzaldehyde (PubChem CID 84722173) has the molecular formula C9H6F4O and a molecular weight of 206.14 g/mol. Its IUPAC name is 3-(1,1,2,2-tetrafluoroethyl)benzaldehyde.
| Compound Name | 3-(1,1,2,2-tetrafluoroethyl)benzaldehyde |
|---|---|
| PubChem CID | 84722173 |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.14 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 3-(1,1,2,2-tetrafluoroethyl)benzaldehyde |
| SMILES | O=Cc1cccc(C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C9H6F4O/c10-8(11)9(12,13)7-3-1-2-6(4-7)5-14/h1-5,8H |
| InChIKey | UIGZPAWZNJUENP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.14 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|