C11H14F4Si — CID 138756095
trimethyl-[3-(1,1,2,2-tetrafluoroethyl)phenyl]silane (PubChem CID 138756095) has the molecular formula C11H14F4Si and a molecular weight of 250.31 g/mol. Its IUPAC name is trimethyl-[3-(1,1,2,2-tetrafluoroethyl)phenyl]silane.
| Compound Name | trimethyl-[3-(1,1,2,2-tetrafluoroethyl)phenyl]silane |
|---|---|
| PubChem CID | 138756095 |
| Molecular Formula | C11H14F4Si |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | trimethyl-[3-(1,1,2,2-tetrafluoroethyl)phenyl]silane |
| SMILES | C[Si](C)(C)c1cccc(C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C11H14F4Si/c1-16(2,3)9-6-4-5-8(7-9)11(14,15)10(12)13/h4-7,10H,1-3H3 |
| InChIKey | NRFFJYYNWLELNG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|