C13H16F3NO — CID 174337968
pent-1-ene;3-(trifluoromethyl)benzamide (PubChem CID 174337968) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is pent-1-ene;3-(trifluoromethyl)benzamide.
| Compound Name | pent-1-ene;3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174337968 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | pent-1-ene;3-(trifluoromethyl)benzamide |
| SMILES | C=CCCC.NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H6F3NO.C5H10/c9-8(10,11)6-3-1-2-5(4-6)7(12)13;1-3-5-4-2/h1-4H,(H2,12,13);3H,1,4-5H2,2H3 |
| InChIKey | OSKAGTQHHXNSSF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|