C17H15F3N2O — CID 71870789
N-(pyridin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide (PubChem CID 71870789) has the molecular formula C17H15F3N2O and a molecular weight of 320.31 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide.
| Compound Name | N-(pyridin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 71870789 |
| Molecular Formula | C17H15F3N2O |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]but-2-enamide |
| SMILES | CC(=CC(=O)NCc1ccccn1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N2O/c1-12(13-5-4-6-14(10-13)17(18,19)20)9-16(23)22-11-15-7-2-3-8-21-15/h2-10H,11H2,1H3,(H,22,23) |
| InChIKey | DGVAWEYTDQTNRT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|