C16H17F3N2O — CID 111121601
1-(pyridin-2-ylmethylamino)-2-[3-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 111121601) has the molecular formula C16H17F3N2O and a molecular weight of 310.32 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethylamino)-2-[3-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 1-(pyridin-2-ylmethylamino)-2-[3-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 111121601 |
| Molecular Formula | C16H17F3N2O |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-(pyridin-2-ylmethylamino)-2-[3-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | CC(O)(CNCc1ccccn1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F3N2O/c1-15(22,11-20-10-14-7-2-3-8-21-14)12-5-4-6-13(9-12)16(17,18)19/h2-9,20,22H,10-11H2,1H3 |
| InChIKey | CYAGQMVXKFKUDV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |