C15H14ClF3N2O — CID 133473010
2-(3-chlorophenyl)-1-[[4-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol (PubChem CID 133473010) has the molecular formula C15H14ClF3N2O and a molecular weight of 330.74 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[[4-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol.
| Compound Name | 2-(3-chlorophenyl)-1-[[4-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 133473010 |
| Molecular Formula | C15H14ClF3N2O |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[[4-(trifluoromethyl)-2-pyridinyl]amino]propan-2-ol |
| SMILES | CC(O)(CNc1cc(C(F)(F)F)ccn1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H14ClF3N2O/c1-14(22,10-3-2-4-12(16)7-10)9-21-13-8-11(5-6-20-13)15(17,18)19/h2-8,22H,9H2,1H3,(H,20,21) |
| InChIKey | NXRSXVYZHVNHSV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |