C16H17Cl2N3O — CID 133473167
1-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]-2-(3-chlorophenyl)propan-2-ol (PubChem CID 133473167) has the molecular formula C16H17Cl2N3O and a molecular weight of 338.24 g/mol. Its IUPAC name is 1-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]-2-(3-chlorophenyl)propan-2-ol.
| Compound Name | 1-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]-2-(3-chlorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 133473167 |
| Molecular Formula | C16H17Cl2N3O |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]-2-(3-chlorophenyl)propan-2-ol |
| SMILES | CC(O)(CNc1cc(Cl)nc(C2CC2)n1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2N3O/c1-16(22,11-3-2-4-12(17)7-11)9-19-14-8-13(18)20-15(21-14)10-5-6-10/h2-4,7-8,10,22H,5-6,9H2,1H3,(H,19,20,21) |
| InChIKey | AKQWTVVQJIULRV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |