C11H14ClF3N2 — CID 107320732
N-(5-chloropentyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 107320732) has the molecular formula C11H14ClF3N2 and a molecular weight of 266.69 g/mol. Its IUPAC name is N-(5-chloropentyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(5-chloropentyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107320732 |
| Molecular Formula | C11H14ClF3N2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-(5-chloropentyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccnc(NCCCCCCl)c1 |
| InChI | InChI=1S/C11H14ClF3N2/c12-5-2-1-3-6-16-10-8-9(4-7-17-10)11(13,14)15/h4,7-8H,1-3,5-6H2,(H,16,17) |
| InChIKey | SLSJUFLSNFUUJB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|