C11H14ClF3N2 — CID 115363721
N-(3-chloro-2,2-dimethylpropyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 115363721) has the molecular formula C11H14ClF3N2 and a molecular weight of 266.69 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylpropyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(3-chloro-2,2-dimethylpropyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115363721 |
| Molecular Formula | C11H14ClF3N2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-(3-chloro-2,2-dimethylpropyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)(CCl)CNc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C11H14ClF3N2/c1-10(2,6-12)7-17-9-5-8(3-4-16-9)11(13,14)15/h3-5H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | MBPLFTWGIJCAEC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|