C10H12ClF3N2 — CID 66330886
N-(3-chlorobutyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 66330886) has the molecular formula C10H12ClF3N2 and a molecular weight of 252.67 g/mol. Its IUPAC name is N-(3-chlorobutyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(3-chlorobutyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 66330886 |
| Molecular Formula | C10H12ClF3N2 |
| Molecular Weight | 252.67 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | N-(3-chlorobutyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(Cl)CCNc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C10H12ClF3N2/c1-7(11)2-4-15-9-6-8(3-5-16-9)10(12,13)14/h3,5-7H,2,4H2,1H3,(H,15,16) |
| InChIKey | XRRQXUYMEFOBPJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.67 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|