C12H18F3N3 — CID 114151133
2-methyl-N'-[4-(trifluoromethyl)-2-pyridinyl]pentane-1,5-diamine (PubChem CID 114151133) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-methyl-N'-[4-(trifluoromethyl)-2-pyridinyl]pentane-1,5-diamine.
| Compound Name | 2-methyl-N'-[4-(trifluoromethyl)-2-pyridinyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 114151133 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-methyl-N'-[4-(trifluoromethyl)-2-pyridinyl]pentane-1,5-diamine |
| SMILES | CC(CN)CCCNc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C12H18F3N3/c1-9(8-16)3-2-5-17-11-7-10(4-6-18-11)12(13,14)15/h4,6-7,9H,2-3,5,8,16H2,1H3,(H,17,18) |
| InChIKey | FGIREWANSQWQRD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|