C11H15F3N2OS — CID 115715774
N-(3-methylsulfinylbutyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 115715774) has the molecular formula C11H15F3N2OS and a molecular weight of 280.31 g/mol. Its IUPAC name is N-(3-methylsulfinylbutyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(3-methylsulfinylbutyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115715774 |
| Molecular Formula | C11H15F3N2OS |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | N-(3-methylsulfinylbutyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(CCNc1cc(C(F)(F)F)ccn1)S(C)=O |
| InChI | InChI=1S/C11H15F3N2OS/c1-8(18(2)17)3-5-15-10-7-9(4-6-16-10)11(12,13)14/h4,6-8H,3,5H2,1-2H3,(H,15,16) |
| InChIKey | OHBJWSFLWQKXLM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |