C11H14ClF3N2OS — CID 102716198
6-chloro-N-(3-methylsulfinylbutyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102716198) has the molecular formula C11H14ClF3N2OS and a molecular weight of 314.76 g/mol. Its IUPAC name is 6-chloro-N-(3-methylsulfinylbutyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(3-methylsulfinylbutyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102716198 |
| Molecular Formula | C11H14ClF3N2OS |
| Molecular Weight | 314.76 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 6-chloro-N-(3-methylsulfinylbutyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(CCNc1cc(C(F)(F)F)cc(Cl)n1)S(C)=O |
| InChI | InChI=1S/C11H14ClF3N2OS/c1-7(19(2)18)3-4-16-10-6-8(11(13,14)15)5-9(12)17-10/h5-7H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | USLNKSFJRBGYAW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.76 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|