C10H13F3N2O — CID 66329465
4-[[4-(trifluoromethyl)-2-pyridinyl]amino]butan-2-ol (PubChem CID 66329465) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 4-[[4-(trifluoromethyl)-2-pyridinyl]amino]butan-2-ol.
| Compound Name | 4-[[4-(trifluoromethyl)-2-pyridinyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 66329465 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-[[4-(trifluoromethyl)-2-pyridinyl]amino]butan-2-ol |
| SMILES | CC(O)CCNc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C10H13F3N2O/c1-7(16)2-4-14-9-6-8(3-5-15-9)10(11,12)13/h3,5-7,16H,2,4H2,1H3,(H,14,15) |
| InChIKey | JYWKQWNHMZTOPW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |