C15H21F3N2 — CID 66330850
N-[2-(4-methylcyclohexyl)ethyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 66330850) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is N-[2-(4-methylcyclohexyl)ethyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[2-(4-methylcyclohexyl)ethyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 66330850 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-[2-(4-methylcyclohexyl)ethyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1CCC(CCNc2cc(C(F)(F)F)ccn2)CC1 |
| InChI | InChI=1S/C15H21F3N2/c1-11-2-4-12(5-3-11)6-8-19-14-10-13(7-9-20-14)15(16,17)18/h7,9-12H,2-6,8H2,1H3,(H,19,20) |
| InChIKey | KYHKPBBBVMPQRL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |