C14H14F3N3O — CID 66328499
N-[2-(4-aminophenoxy)ethyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 66328499) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is N-[2-(4-aminophenoxy)ethyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[2-(4-aminophenoxy)ethyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 66328499 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[2-(4-aminophenoxy)ethyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1ccc(OCCNc2cc(C(F)(F)F)ccn2)cc1 |
| InChI | InChI=1S/C14H14F3N3O/c15-14(16,17)10-5-6-19-13(9-10)20-7-8-21-12-3-1-11(18)2-4-12/h1-6,9H,7-8,18H2,(H,19,20) |
| InChIKey | FNGMQCQBHRZLFQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|