C18H18F3N3O2S — CID 4273202
2-acetamido-N-(pyridin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]sulfanylpropanamide (PubChem CID 4273202) has the molecular formula C18H18F3N3O2S and a molecular weight of 397.42 g/mol. Its IUPAC name is 2-acetamido-N-(pyridin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(pyridin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 4273202 |
| Molecular Formula | C18H18F3N3O2S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-acetamido-N-(pyridin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]sulfanylpropanamide |
| SMILES | CC(=O)NC(CSc1cccc(C(F)(F)F)c1)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C18H18F3N3O2S/c1-12(25)24-16(17(26)23-10-14-6-2-3-8-22-14)11-27-15-7-4-5-13(9-15)18(19,20)21/h2-9,16H,10-11H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | YTVGZCNPYDOHJJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |